C13H17FN4O2 — CID 59185445
[(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3,4-dimethyloxolan-2-yl]methanol (PubChem CID 59185445) has the molecular formula C13H17FN4O2 and a molecular weight of 280.30 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3,4-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3,4-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185445 |
| Molecular Formula | C13H17FN4O2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [(2S,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3,4-dimethyloxolan-2-yl]methanol |
| SMILES | C[C@@H]1[C@@H](CO)O[C@@H](c2ccc3c(N)ncnn23)[C@]1(C)F |
| InChI | InChI=1S/C13H17FN4O2/c1-7-10(5-19)20-11(13(7,2)14)8-3-4-9-12(15)16-6-17-18(8)9/h3-4,6-7,10-11,19H,5H2,1-2H3,(H2,15,16,17)/t7-,10-,11+,13-/m1/s1 |
| InChIKey | PJHVIXPKEWYKHE-DRYIUFOISA-N |
| XLogP | 1.11 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |