C17H21N5O2S — CID 59185455
[(2S,3S,5R)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,4-trimethyloxolan-2-yl]methanol (PubChem CID 59185455) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is [(2S,3S,5R)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,4-trimethyloxolan-2-yl]methanol.
| Compound Name | [(2S,3S,5R)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,4-trimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185455 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [(2S,3S,5R)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,4-trimethyloxolan-2-yl]methanol |
| SMILES | C[C@@H]1[C@@H](CO)O[C@@H](c2cc(-c3nccs3)c3c(N)ncnn23)C1(C)C |
| InChI | InChI=1S/C17H21N5O2S/c1-9-12(7-23)24-14(17(9,2)3)11-6-10(16-19-4-5-25-16)13-15(18)20-8-21-22(11)13/h4-6,8-9,12,14,23H,7H2,1-3H3,(H2,18,20,21)/t9-,12-,14+/m1/s1 |
| InChIKey | BVIXZECKXRGMTM-IUPBHXKESA-N |
| XLogP | 2.53 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |