C15H18FN7O2 — CID 59185457
[(2R,3S,5R)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3-fluoro-4,4-dimethyloxolan-2-yl]methanol (PubChem CID 59185457) has the molecular formula C15H18FN7O2 and a molecular weight of 347.35 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3-fluoro-4,4-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2R,3S,5R)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3-fluoro-4,4-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185457 |
| Molecular Formula | C15H18FN7O2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [(2R,3S,5R)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3-fluoro-4,4-dimethyloxolan-2-yl]methanol |
| SMILES | CC1(C)[C@H](F)[C@@H](CO)O[C@H]1c1cc(-c2cn[nH]n2)c2c(N)ncnn12 |
| InChI | InChI=1S/C15H18FN7O2/c1-15(2)12(16)10(5-24)25-13(15)9-3-7(8-4-19-22-21-8)11-14(17)18-6-20-23(9)11/h3-4,6,10,12-13,24H,5H2,1-2H3,(H2,17,18,20)(H,19,21,22)/t10-,12-,13+/m1/s1 |
| InChIKey | FZFPUGGZRDIQKR-RTXFEEFZSA-N |
| XLogP | 0.89 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |