C14H18FN5O3 — CID 59185465
4-amino-7-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)-3,3-dimethyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide (PubChem CID 59185465) has the molecular formula C14H18FN5O3 and a molecular weight of 323.33 g/mol. Its IUPAC name is 4-amino-7-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)-3,3-dimethyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide.
| Compound Name | 4-amino-7-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)-3,3-dimethyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide |
|---|---|
| PubChem CID | 59185465 |
| Molecular Formula | C14H18FN5O3 |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-amino-7-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)-3,3-dimethyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide |
| SMILES | CC1(C)[C@H](F)[C@@H](CO)O[C@H]1c1cc(C(N)=O)c2c(N)ncnn12 |
| InChI | InChI=1S/C14H18FN5O3/c1-14(2)10(15)8(4-21)23-11(14)7-3-6(13(17)22)9-12(16)18-5-19-20(7)9/h3,5,8,10-11,21H,4H2,1-2H3,(H2,17,22)(H2,16,18,19)/t8-,10-,11+/m1/s1 |
| InChIKey | WDKRGAWKVPNCDO-IEBDPFPHSA-N |
| XLogP | 0.21 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |