C15H20N4O4 — CID 59185478
4-amino-7-[(2R,4S,5S)-5-(hydroxymethyl)-3,3,4-trimethyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid (PubChem CID 59185478) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 4-amino-7-[(2R,4S,5S)-5-(hydroxymethyl)-3,3,4-trimethyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid.
| Compound Name | 4-amino-7-[(2R,4S,5S)-5-(hydroxymethyl)-3,3,4-trimethyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid |
|---|---|
| PubChem CID | 59185478 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-amino-7-[(2R,4S,5S)-5-(hydroxymethyl)-3,3,4-trimethyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid |
| SMILES | C[C@@H]1[C@@H](CO)O[C@@H](c2cc(C(=O)O)c3c(N)ncnn23)C1(C)C |
| InChI | InChI=1S/C15H20N4O4/c1-7-10(5-20)23-12(15(7,2)3)9-4-8(14(21)22)11-13(16)17-6-18-19(9)11/h4,6-7,10,12,20H,5H2,1-3H3,(H,21,22)(H2,16,17,18)/t7-,10-,12+/m1/s1 |
| InChIKey | OGJHWBSATOICSV-XXFPWJFMSA-N |
| XLogP | 1.10 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |