C16H18N8O2S — CID 59185484
[(2S,3S,4R,5R)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-azido-3,4-dimethyloxolan-2-yl]methanol (PubChem CID 59185484) has the molecular formula C16H18N8O2S and a molecular weight of 386.44 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-azido-3,4-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2S,3S,4R,5R)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-azido-3,4-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185484 |
| Molecular Formula | C16H18N8O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-azido-3,4-dimethyloxolan-2-yl]methanol |
| SMILES | C[C@H]1[C@H](c2cc(-c3nccs3)c3c(N)ncnn23)O[C@@](CO)(N=[N+]=[N-])[C@H]1C |
| InChI | InChI=1S/C16H18N8O2S/c1-8-9(2)16(6-25,22-23-18)26-13(8)11-5-10(15-19-3-4-27-15)12-14(17)20-7-21-24(11)12/h3-5,7-9,13,25H,6H2,1-2H3,(H2,17,20,21)/t8-,9+,13-,16-/m1/s1 |
| InChIKey | VHWFLNDFKXWGEC-XJRPMAQBSA-N |
| XLogP | 2.78 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|