C16H18FN5O3 — CID 59185502
[(2R,3S,5R)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3-fluoro-4,4-dimethyloxolan-2-yl]methanol (PubChem CID 59185502) has the molecular formula C16H18FN5O3 and a molecular weight of 347.35 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3-fluoro-4,4-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2R,3S,5R)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3-fluoro-4,4-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185502 |
| Molecular Formula | C16H18FN5O3 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | [(2R,3S,5R)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3-fluoro-4,4-dimethyloxolan-2-yl]methanol |
| SMILES | CC1(C)[C@H](F)[C@@H](CO)O[C@H]1c1cc(-c2ncco2)c2c(N)ncnn12 |
| InChI | InChI=1S/C16H18FN5O3/c1-16(2)12(17)10(6-23)25-13(16)9-5-8(15-19-3-4-24-15)11-14(18)20-7-21-22(9)11/h3-5,7,10,12-13,23H,6H2,1-2H3,(H2,18,20,21)/t10-,12-,13+/m1/s1 |
| InChIKey | NBOWMCNUWFBUFJ-RTXFEEFZSA-N |
| XLogP | 1.76 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |