C13H16ClFN4O2 — CID 59185507
[(2R,3S,5R)-5-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol (PubChem CID 59185507) has the molecular formula C13H16ClFN4O2 and a molecular weight of 314.75 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2R,3S,5R)-5-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185507 |
| Molecular Formula | C13H16ClFN4O2 |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol |
| SMILES | CC1(C)[C@H](F)[C@@H](CO)O[C@H]1c1cc(Cl)c2c(N)ncnn12 |
| InChI | InChI=1S/C13H16ClFN4O2/c1-13(2)10(15)8(4-20)21-11(13)7-3-6(14)9-12(16)17-5-18-19(7)9/h3,5,8,10-11,20H,4H2,1-2H3,(H2,16,17,18)/t8-,10-,11+/m1/s1 |
| InChIKey | GVBXKJHEIVCFJI-IEBDPFPHSA-N |
| XLogP | 1.76 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |