C14H16FN5O2 — CID 59185518
[(2R,3S,5R)-5-(4-amino-5-isocyanopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol (PubChem CID 59185518) has the molecular formula C14H16FN5O2 and a molecular weight of 305.31 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-5-isocyanopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2R,3S,5R)-5-(4-amino-5-isocyanopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185518 |
| Molecular Formula | C14H16FN5O2 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-5-isocyanopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4,4-dimethyloxolan-2-yl]methanol |
| SMILES | [C-]#[N+]c1cc([C@@H]2O[C@H](CO)[C@@H](F)C2(C)C)n2ncnc(N)c12 |
| InChI | InChI=1S/C14H16FN5O2/c1-14(2)11(15)9(5-21)22-12(14)8-4-7(17-3)10-13(16)18-6-19-20(8)10/h4,6,9,11-12,21H,5H2,1-2H3,(H2,16,18,19)/t9-,11-,12+/m1/s1 |
| InChIKey | GWPCKCHZKSPQJG-JLLWLGSASA-N |
| XLogP | 1.66 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|