C13H16FN5O2S — CID 59185533
4-amino-7-[(2S,3R,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carbothioamide (PubChem CID 59185533) has the molecular formula C13H16FN5O2S and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-amino-7-[(2S,3R,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carbothioamide.
| Compound Name | 4-amino-7-[(2S,3R,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carbothioamide |
|---|---|
| PubChem CID | 59185533 |
| Molecular Formula | C13H16FN5O2S |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-amino-7-[(2S,3R,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carbothioamide |
| SMILES | C[C@H]1[C@@H](F)[C@H](c2cc(C(N)=S)c3c(N)ncnn23)O[C@@H]1CO |
| InChI | InChI=1S/C13H16FN5O2S/c1-5-8(3-20)21-11(9(5)14)7-2-6(13(16)22)10-12(15)17-4-18-19(7)10/h2,4-5,8-9,11,20H,3H2,1H3,(H2,16,22)(H2,15,17,18)/t5-,8-,9-,11+/m1/s1 |
| InChIKey | DDBBBROIURTPID-HUQDZECVSA-N |
| XLogP | 0.35 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|