C13H16FN5O3 — CID 59185536
4-amino-7-[(2S,3S,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide (PubChem CID 59185536) has the molecular formula C13H16FN5O3 and a molecular weight of 309.30 g/mol. Its IUPAC name is 4-amino-7-[(2S,3S,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide.
| Compound Name | 4-amino-7-[(2S,3S,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide |
|---|---|
| PubChem CID | 59185536 |
| Molecular Formula | C13H16FN5O3 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 4-amino-7-[(2S,3S,4R,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide |
| SMILES | C[C@H]1[C@H](F)[C@H](c2cc(C(N)=O)c3c(N)ncnn23)O[C@@H]1CO |
| InChI | InChI=1S/C13H16FN5O3/c1-5-8(3-20)22-11(9(5)14)7-2-6(13(16)21)10-12(15)17-4-18-19(7)10/h2,4-5,8-9,11,20H,3H2,1H3,(H2,16,21)(H2,15,17,18)/t5-,8-,9+,11+/m1/s1 |
| InChIKey | YNIRWGDSXIFMOE-YBPSPAFDSA-N |
| XLogP | -0.18 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |