About ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate
ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate (PubChem CID 59185550) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate |
| PubChem CID | 59185550 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate |
| SMILES | C=CCNC1=C/C(=C(/C#N)C(=O)OCC)CC(C)(C)C1 |
| InChI | InChI=1S/C16H22N2O2/c1-5-7-18-13-8-12(9-16(3,4)10-13)14(11-17)15(19)20-6-2/h5,8,18H,1,6-7,9-10H2,2-4H3/b14-12+ |
| InChIKey | RPAOVUGEGIUOGZ-WYMLVPIESA-N |
| XLogP | 2.85 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate?
The IUPAC name of ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate (CID 59185550) is ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate.
What is the SMILES notation for ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate?
The canonical SMILES for ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate is C=CCNC1=C/C(=C(/C#N)C(=O)OCC)CC(C)(C)C1.
What is the InChIKey of ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate?
The InChIKey is RPAOVUGEGIUOGZ-WYMLVPIESA-N. The full InChI is InChI=1S/C16H22N2O2/c1-5-7-18-13-8-12(9-16(3,4)10-13)14(11-17)15(19)20-6-2/h5,8,18H,1,6-7,9-10H2,2-4H3/b14-12+.
What are the key properties of ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate?
ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate has a molecular weight of 274.36 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-cyano-2-[5,5-dimethyl-3-(prop-2-enylamino)cyclohex-2-en-1-ylidene]acetate is sourced from PubChem (CID 59185550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).