About 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine
6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine (PubChem CID 59185562) has the molecular formula C9H9N7O2S
and a molecular weight of 279.29 g/mol. Its IUPAC name is 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine.
Molecular Properties
| Compound Name | 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine |
| PubChem CID | 59185562 |
| Molecular Formula | C9H9N7O2S |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine |
| SMILES | Cn1cnc([N+](=O)[O-])c1Sc1ncnc2c1NCN2 |
| InChI | InChI=1S/C9H9N7O2S/c1-15-4-14-7(16(17)18)9(15)19-8-5-6(11-2-10-5)12-3-13-8/h3-4,10H,2H2,1H3,(H,11,12,13) |
| InChIKey | FBYWLGANUBTFFR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine?
The IUPAC name of 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine (CID 59185562) is 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine.
What is the SMILES notation for 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine?
The canonical SMILES for 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine is Cn1cnc([N+](=O)[O-])c1Sc1ncnc2c1NCN2.
What is the InChIKey of 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine?
The InChIKey is FBYWLGANUBTFFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N7O2S/c1-15-4-14-7(16(17)18)9(15)19-8-5-6(11-2-10-5)12-3-13-8/h3-4,10H,2H2,1H3,(H,11,12,13).
What are the key properties of 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine?
6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine has a molecular weight of 279.29 g/mol, XLogP of 1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-8,9-dihydro-7H-purine is sourced from PubChem (CID 59185562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).