C24H26N6O2S — CID 59186482
N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(3-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 59186482) has the molecular formula C24H26N6O2S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(3-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(3-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 59186482 |
| Molecular Formula | C24H26N6O2S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(3-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nc4cccc(-c5cccc(S(C)(=O)=O)c5)n4n3)cc2)CC1 |
| InChI | InChI=1S/C24H26N6O2S/c1-28-13-15-29(16-14-28)20-11-9-19(10-12-20)25-24-26-23-8-4-7-22(30(23)27-24)18-5-3-6-21(17-18)33(2,31)32/h3-12,17H,13-16H2,1-2H3,(H,25,27) |
| InChIKey | XEFMGFQXNLZBQW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|