C11H13F3N2S — CID 59186545
7-methyl-1,1-dimethylidene-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine (PubChem CID 59186545) has the molecular formula C11H13F3N2S and a molecular weight of 262.30 g/mol. Its IUPAC name is 7-methyl-1,1-dimethylidene-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine.
| Compound Name | 7-methyl-1,1-dimethylidene-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 59186545 |
| Molecular Formula | C11H13F3N2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 7-methyl-1,1-dimethylidene-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine |
| SMILES | C=S1(=C)NCNc2cc(C(F)(F)F)c(C)cc21 |
| InChI | InChI=1S/C11H13F3N2S/c1-7-4-10-9(5-8(7)11(12,13)14)15-6-16-17(10,2)3/h4-5,15-16H,2-3,6H2,1H3 |
| InChIKey | FBTGXCMFMCHEID-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|