About 1,8-dimethyl-1,8-diazaspiro[3.4]octane
1,8-dimethyl-1,8-diazaspiro[3.4]octane (PubChem CID 59187033) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 1,8-dimethyl-1,8-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 1,8-dimethyl-1,8-diazaspiro[3.4]octane |
| PubChem CID | 59187033 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1,8-dimethyl-1,8-diazaspiro[3.4]octane |
| SMILES | CN1CCCC12CCN2C |
| InChI | InChI=1S/C8H16N2/c1-9-6-3-4-8(9)5-7-10(8)2/h3-7H2,1-2H3 |
| InChIKey | FHZCPWDGQSVXRT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,8-dimethyl-1,8-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dimethyl-1,8-diazaspiro[3.4]octane?
The IUPAC name of 1,8-dimethyl-1,8-diazaspiro[3.4]octane (CID 59187033) is 1,8-dimethyl-1,8-diazaspiro[3.4]octane.
What is the SMILES notation for 1,8-dimethyl-1,8-diazaspiro[3.4]octane?
The canonical SMILES for 1,8-dimethyl-1,8-diazaspiro[3.4]octane is CN1CCCC12CCN2C.
What is the InChIKey of 1,8-dimethyl-1,8-diazaspiro[3.4]octane?
The InChIKey is FHZCPWDGQSVXRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-9-6-3-4-8(9)5-7-10(8)2/h3-7H2,1-2H3.
What are the key properties of 1,8-dimethyl-1,8-diazaspiro[3.4]octane?
1,8-dimethyl-1,8-diazaspiro[3.4]octane has a molecular weight of 140.23 g/mol, XLogP of 0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dimethyl-1,8-diazaspiro[3.4]octane is sourced from PubChem (CID 59187033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).