About 1,5-dimethyl-1,5-diazaspiro[3.3]heptane
1,5-dimethyl-1,5-diazaspiro[3.3]heptane (PubChem CID 59187038) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 1,5-dimethyl-1,5-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 1,5-dimethyl-1,5-diazaspiro[3.3]heptane |
| PubChem CID | 59187038 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 1,5-dimethyl-1,5-diazaspiro[3.3]heptane |
| SMILES | CN1CCC12CCN2C |
| InChI | InChI=1S/C7H14N2/c1-8-5-3-7(8)4-6-9(7)2/h3-6H2,1-2H3 |
| InChIKey | JIXDSMQWDKTUGK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethyl-1,5-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-1,5-diazaspiro[3.3]heptane?
The IUPAC name of 1,5-dimethyl-1,5-diazaspiro[3.3]heptane (CID 59187038) is 1,5-dimethyl-1,5-diazaspiro[3.3]heptane.
What is the SMILES notation for 1,5-dimethyl-1,5-diazaspiro[3.3]heptane?
The canonical SMILES for 1,5-dimethyl-1,5-diazaspiro[3.3]heptane is CN1CCC12CCN2C.
What is the InChIKey of 1,5-dimethyl-1,5-diazaspiro[3.3]heptane?
The InChIKey is JIXDSMQWDKTUGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-8-5-3-7(8)4-6-9(7)2/h3-6H2,1-2H3.
What are the key properties of 1,5-dimethyl-1,5-diazaspiro[3.3]heptane?
1,5-dimethyl-1,5-diazaspiro[3.3]heptane has a molecular weight of 126.20 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-1,5-diazaspiro[3.3]heptane is sourced from PubChem (CID 59187038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).