C22H40N4O5S — CID 59187273
(2S)-6-amino-2-[[(2S)-3-cyclopropyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]hexanoic acid (PubChem CID 59187273) has the molecular formula C22H40N4O5S and a molecular weight of 472.65 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-3-cyclopropyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-3-cyclopropyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 59187273 |
| Molecular Formula | C22H40N4O5S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-3-cyclopropyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]hexanoic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](NC(=O)[C@H](CC1CC1)NS(=O)(=O)N[C@@H](CCCCN)C(=O)O)C2 |
| InChI | InChI=1S/C22H40N4O5S/c1-21(2)15-9-10-22(21,3)18(13-15)24-19(27)17(12-14-7-8-14)26-32(30,31)25-16(20(28)29)6-4-5-11-23/h14-18,25-26H,4-13,23H2,1-3H3,(H,24,27)(H,28,29)/t15-,16+,17+,18+,22+/m1/s1 |
| InChIKey | NMXBBBBKSIKPCR-JVOBEXOSSA-N |
| XLogP | 1.49 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|