C26H48N4O5S — CID 59187291
(2S)-6-amino-2-[[(2S)-4-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]butan-2-yl]sulfamoylamino]hexanoic acid (PubChem CID 59187291) has the molecular formula C26H48N4O5S and a molecular weight of 528.76 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-4-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]butan-2-yl]sulfamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-4-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]butan-2-yl]sulfamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 59187291 |
| Molecular Formula | C26H48N4O5S |
| Molecular Weight | 528.76 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-4-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]butan-2-yl]sulfamoylamino]hexanoic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](NC(=O)[C@H](CCC1CCCCC1)NS(=O)(=O)N[C@@H](CCCCN)C(=O)O)C2 |
| InChI | InChI=1S/C26H48N4O5S/c1-25(2)19-14-15-26(25,3)22(17-19)28-23(31)20(13-12-18-9-5-4-6-10-18)29-36(34,35)30-21(24(32)33)11-7-8-16-27/h18-22,29-30H,4-17,27H2,1-3H3,(H,28,31)(H,32,33)/t19-,20+,21+,22+,26+/m1/s1 |
| InChIKey | XLOARNQKSYTPBM-RZFRIWOHSA-N |
| XLogP | 3.05 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|