C29H46N6O7 — CID 59187301
(2S)-6-amino-2-[[(2R)-1-[[(2S)-1-(cyclopropylamino)-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 59187301) has the molecular formula C29H46N6O7 and a molecular weight of 590.72 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-1-[[(2S)-1-(cyclopropylamino)-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2R)-1-[[(2S)-1-(cyclopropylamino)-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 59187301 |
| Molecular Formula | C29H46N6O7 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-1-[[(2S)-1-(cyclopropylamino)-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](CCCCNC(=O)OCc1ccccc1)NC(=O)N[C@@H](CCCCN)C(=O)O)C(=O)NC1CC1 |
| InChI | InChI=1S/C29H46N6O7/c1-19(2)24(26(37)32-21-14-15-21)35-25(36)22(33-28(40)34-23(27(38)39)13-6-8-16-30)12-7-9-17-31-29(41)42-18-20-10-4-3-5-11-20/h3-5,10-11,19,21-24H,6-9,12-18,30H2,1-2H3,(H,31,41)(H,32,37)(H,35,36)(H,38,39)(H2,33,34,40)/t22-,23+,24+/m1/s1 |
| InChIKey | NWXNQDHLMQUILK-SGNDLWITSA-N |
| XLogP | 1.75 |
| TPSA | 200.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|