C25H46N6O5S — CID 59187340
(2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 59187340) has the molecular formula C25H46N6O5S and a molecular weight of 542.75 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 59187340 |
| Molecular Formula | C25H46N6O5S |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | (2S)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](NC(=O)[C@H](CC1CCCCC1)NS(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)O)C2 |
| InChI | InChI=1S/C25H46N6O5S/c1-24(2)17-11-12-25(24,3)20(15-17)29-21(32)19(14-16-8-5-4-6-9-16)31-37(35,36)30-18(22(33)34)10-7-13-28-23(26)27/h16-20,30-31H,4-15H2,1-3H3,(H,29,32)(H,33,34)(H4,26,27,28)/t17-,18+,19+,20+,25+/m1/s1 |
| InChIKey | IXONGSRYYIUNOM-PDGNJTGUSA-N |
| XLogP | 1.59 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|