C33H30N4O6 — CID 59187580
benzyl N-[(9S,16S,19S)-22-formyl-17-oxo-19-propan-2-yl-10,26-dioxa-8,18,21-triazahexacyclo[12.9.2.120,23.01,9.02,7.011,24]hexacosa-2,4,6,11(24),12,14(25),20,22-octaen-16-yl]carbamate (PubChem CID 59187580) has the molecular formula C33H30N4O6 and a molecular weight of 578.63 g/mol. Its IUPAC name is benzyl N-[(9S,16S,19S)-22-formyl-17-oxo-19-propan-2-yl-10,26-dioxa-8,18,21-triazahexacyclo[12.9.2.120,23.01,9.02,7.011,24]hexacosa-2,4,6,11(24),12,14(25),20,22-octaen-16-yl]carbamate.
| Compound Name | benzyl N-[(9S,16S,19S)-22-formyl-17-oxo-19-propan-2-yl-10,26-dioxa-8,18,21-triazahexacyclo[12.9.2.120,23.01,9.02,7.011,24]hexacosa-2,4,6,11(24),12,14(25),20,22-octaen-16-yl]carbamate |
|---|---|
| PubChem CID | 59187580 |
| Molecular Formula | C33H30N4O6 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | benzyl N-[(9S,16S,19S)-22-formyl-17-oxo-19-propan-2-yl-10,26-dioxa-8,18,21-triazahexacyclo[12.9.2.120,23.01,9.02,7.011,24]hexacosa-2,4,6,11(24),12,14(25),20,22-octaen-16-yl]carbamate |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](NC(=O)OCc2ccccc2)Cc2ccc3c(c2)C2(c4ccccc4N[C@H]2O3)c2oc1nc2C=O |
| InChI | InChI=1S/C33H30N4O6/c1-18(2)27-30-34-25(16-38)28(43-30)33-21-10-6-7-11-23(21)35-31(33)42-26-13-12-20(14-22(26)33)15-24(29(39)37-27)36-32(40)41-17-19-8-4-3-5-9-19/h3-14,16,18,24,27,31,35H,15,17H2,1-2H3,(H,36,40)(H,37,39)/t24-,27-,31-,33?/m0/s1 |
| InChIKey | FTOSZQGSELCWTG-GQHRAYAUSA-N |
| XLogP | 4.63 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|