C23H36O4 — CID 59187722
[(1R,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-methylidene-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate (PubChem CID 59187722) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is [(1R,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-methylidene-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate.
| Compound Name | [(1R,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-methylidene-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 59187722 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | [(1R,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-methylidene-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CO)[C@]2(C)C(C)CC[C@]3(CCC(=C)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C23H36O4/c1-7-21(5)12-17(27-18(25)13-24)22(6)15(3)9-11-23(16(4)20(21)26)10-8-14(2)19(22)23/h7,15-17,19-20,24,26H,1-2,8-13H2,3-6H3/t15?,16-,17+,19?,20-,21+,22-,23+/m0/s1 |
| InChIKey | BUAOYQBNJYFMOR-FSGCBGJPSA-N |
| XLogP | 3.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|