C22H39NO2 — CID 59187760
ethyl (9Z,12Z,15Z)-2-(ethylamino)octadeca-9,12,15-trienoate (PubChem CID 59187760) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is ethyl (9Z,12Z,15Z)-2-(ethylamino)octadeca-9,12,15-trienoate.
| Compound Name | ethyl (9Z,12Z,15Z)-2-(ethylamino)octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 59187760 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | ethyl (9Z,12Z,15Z)-2-(ethylamino)octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(NCC)C(=O)OCC |
| InChI | InChI=1S/C22H39NO2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23-5-2)22(24)25-6-3/h7-8,10-11,13-14,21,23H,4-6,9,12,15-20H2,1-3H3/b8-7-,11-10-,14-13- |
| InChIKey | GNGPJHPULXLZNA-JPFHKJGASA-N |
| XLogP | 5.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|