C21H36O2S — CID 59187763
ethyl (9Z,12Z,15Z)-2-methylsulfanyloctadeca-9,12,15-trienoate (PubChem CID 59187763) has the molecular formula C21H36O2S and a molecular weight of 352.58 g/mol. Its IUPAC name is ethyl (9Z,12Z,15Z)-2-methylsulfanyloctadeca-9,12,15-trienoate.
| Compound Name | ethyl (9Z,12Z,15Z)-2-methylsulfanyloctadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 59187763 |
| Molecular Formula | C21H36O2S |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | ethyl (9Z,12Z,15Z)-2-methylsulfanyloctadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(SC)C(=O)OCC |
| InChI | InChI=1S/C21H36O2S/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(24-3)21(22)23-5-2/h6-7,9-10,12-13,20H,4-5,8,11,14-19H2,1-3H3/b7-6-,10-9-,13-12- |
| InChIKey | CLZJPAIUMHTSES-QNEBEIHSSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|