C24H43NO2 — CID 59187775
ethyl (9Z,12Z,15Z)-2-(diethylamino)octadeca-9,12,15-trienoate (PubChem CID 59187775) has the molecular formula C24H43NO2 and a molecular weight of 377.61 g/mol. Its IUPAC name is ethyl (9Z,12Z,15Z)-2-(diethylamino)octadeca-9,12,15-trienoate.
| Compound Name | ethyl (9Z,12Z,15Z)-2-(diethylamino)octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 59187775 |
| Molecular Formula | C24H43NO2 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 377.33 |
| IUPAC Name | ethyl (9Z,12Z,15Z)-2-(diethylamino)octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(C(=O)OCC)N(CC)CC |
| InChI | InChI=1S/C24H43NO2/c1-5-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24(26)27-8-4)25(6-2)7-3/h9-10,12-13,15-16,23H,5-8,11,14,17-22H2,1-4H3/b10-9-,13-12-,16-15- |
| InChIKey | CBEAPKZVTYMREC-YOILPLPUSA-N |
| XLogP | 6.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|