C23H40O2S — CID 59187793
ethyl (11Z,14Z,17Z)-2-methylsulfanylicosa-11,14,17-trienoate (PubChem CID 59187793) has the molecular formula C23H40O2S and a molecular weight of 380.64 g/mol. Its IUPAC name is ethyl (11Z,14Z,17Z)-2-methylsulfanylicosa-11,14,17-trienoate.
| Compound Name | ethyl (11Z,14Z,17Z)-2-methylsulfanylicosa-11,14,17-trienoate |
|---|---|
| PubChem CID | 59187793 |
| Molecular Formula | C23H40O2S |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | ethyl (11Z,14Z,17Z)-2-methylsulfanylicosa-11,14,17-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCC(SC)C(=O)OCC |
| InChI | InChI=1S/C23H40O2S/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(26-3)23(24)25-5-2/h6-7,9-10,12-13,22H,4-5,8,11,14-21H2,1-3H3/b7-6-,10-9-,13-12- |
| InChIKey | NLAAJCUSXJUQBX-QNEBEIHSSA-N |
| XLogP | 7.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|