C35H50N12O6 — CID 59188261
methyl 2,6-bis[[9-(5-ethyl-3,4-dimethyloxolan-2-yl)purin-6-yl]carbamoylamino]hexanoate (PubChem CID 59188261) has the molecular formula C35H50N12O6 and a molecular weight of 734.86 g/mol. Its IUPAC name is methyl 2,6-bis[[9-(5-ethyl-3,4-dimethyloxolan-2-yl)purin-6-yl]carbamoylamino]hexanoate.
| Compound Name | methyl 2,6-bis[[9-(5-ethyl-3,4-dimethyloxolan-2-yl)purin-6-yl]carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 59188261 |
| Molecular Formula | C35H50N12O6 |
| Molecular Weight | 734.86 g/mol |
| Exact Mass | 734.40 |
| IUPAC Name | methyl 2,6-bis[[9-(5-ethyl-3,4-dimethyloxolan-2-yl)purin-6-yl]carbamoylamino]hexanoate |
| SMILES | CCC1OC(n2cnc3c(NC(=O)NCCCCC(NC(=O)Nc4ncnc5c4ncn5C4OC(CC)C(C)C4C)C(=O)OC)ncnc32)C(C)C1C |
| InChI | InChI=1S/C35H50N12O6/c1-8-23-18(3)20(5)31(52-23)46-16-41-25-27(37-14-39-29(25)46)44-34(49)36-13-11-10-12-22(33(48)51-7)43-35(50)45-28-26-30(40-15-38-28)47(17-42-26)32-21(6)19(4)24(9-2)53-32/h14-24,31-32H,8-13H2,1-7H3,(H2,36,37,39,44,49)(H2,38,40,43,45,50) |
| InChIKey | FCXLNVKTNKESPZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 214.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.86 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|