C33H45N9 — CID 59188412
2,4,6-tris(3,6-dipropylpyrazin-2-yl)-1,3,5-triazine (PubChem CID 59188412) has the molecular formula C33H45N9 and a molecular weight of 567.79 g/mol. Its IUPAC name is 2,4,6-tris(3,6-dipropylpyrazin-2-yl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(3,6-dipropylpyrazin-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 59188412 |
| Molecular Formula | C33H45N9 |
| Molecular Weight | 567.79 g/mol |
| Exact Mass | 567.38 |
| IUPAC Name | 2,4,6-tris(3,6-dipropylpyrazin-2-yl)-1,3,5-triazine |
| SMILES | CCCc1cnc(CCC)c(-c2nc(-c3nc(CCC)cnc3CCC)nc(-c3nc(CCC)cnc3CCC)n2)n1 |
| InChI | InChI=1S/C33H45N9/c1-7-13-22-19-34-25(16-10-4)28(37-22)31-40-32(29-26(17-11-5)35-20-23(38-29)14-8-2)42-33(41-31)30-27(18-12-6)36-21-24(39-30)15-9-3/h19-21H,7-18H2,1-6H3 |
| InChIKey | RBWPGRJTDRRFFT-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.79 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |