About 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine
3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine (PubChem CID 59188431) has the molecular formula C21H32N4
and a molecular weight of 340.51 g/mol. Its IUPAC name is 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine.
Molecular Properties
| Compound Name | 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine |
| PubChem CID | 59188431 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine |
| SMILES | CCCc1cnc(CCC)c(Cc2nc(CCC)cnc2CCC)n1 |
| InChI | InChI=1S/C21H32N4/c1-5-9-16-14-22-18(11-7-3)20(24-16)13-21-19(12-8-4)23-15-17(25-21)10-6-2/h14-15H,5-13H2,1-4H3 |
| InChIKey | GPJKGMSSGHQHAQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine?
The IUPAC name of 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine (CID 59188431) is 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine.
What is the SMILES notation for 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine?
The canonical SMILES for 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine is CCCc1cnc(CCC)c(Cc2nc(CCC)cnc2CCC)n1.
What is the InChIKey of 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine?
The InChIKey is GPJKGMSSGHQHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N4/c1-5-9-16-14-22-18(11-7-3)20(24-16)13-21-19(12-8-4)23-15-17(25-21)10-6-2/h14-15H,5-13H2,1-4H3.
What are the key properties of 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine?
3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine has a molecular weight of 340.51 g/mol, XLogP of 4.67, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,6-dipropylpyrazin-2-yl)methyl]-2,5-dipropylpyrazine is sourced from PubChem (CID 59188431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).