C26H30N2O — CID 59188492
7-[(E)-2-[(4Z)-4-(1-isocyanoethylidene)pyran-2-yl]ethenyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (PubChem CID 59188492) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is 7-[(E)-2-[(4Z)-4-(1-isocyanoethylidene)pyran-2-yl]ethenyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene.
| Compound Name | 7-[(E)-2-[(4Z)-4-(1-isocyanoethylidene)pyran-2-yl]ethenyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
|---|---|
| PubChem CID | 59188492 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 7-[(E)-2-[(4Z)-4-(1-isocyanoethylidene)pyran-2-yl]ethenyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
| SMILES | [C-]#[N+]/C(C)=C1/C=COC(/C=C/c2cc3c4c(c2)C(C)(C)CCN4CCC3(C)C)=C1 |
| InChI | InChI=1S/C26H30N2O/c1-18(27-6)20-9-14-29-21(17-20)8-7-19-15-22-24-23(16-19)26(4,5)11-13-28(24)12-10-25(22,2)3/h7-9,14-17H,10-13H2,1-5H3/b8-7+,20-18- |
| InChIKey | YGMAJLHGOIGFCT-FSGMYKIISA-N |
| XLogP | 6.49 |
| TPSA | 16.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|