C21H31ClN6O3 — CID 59189061
6-chloro-2-N,2-N-bis(2-methoxyethyl)-4-N-(3-methoxypropyl)-5-[(4-methylphenyl)diazenyl]pyrimidine-2,4-diamine (PubChem CID 59189061) has the molecular formula C21H31ClN6O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-bis(2-methoxyethyl)-4-N-(3-methoxypropyl)-5-[(4-methylphenyl)diazenyl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N-bis(2-methoxyethyl)-4-N-(3-methoxypropyl)-5-[(4-methylphenyl)diazenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 59189061 |
| Molecular Formula | C21H31ClN6O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 6-chloro-2-N,2-N-bis(2-methoxyethyl)-4-N-(3-methoxypropyl)-5-[(4-methylphenyl)diazenyl]pyrimidine-2,4-diamine |
| SMILES | COCCCNc1nc(N(CCOC)CCOC)nc(Cl)c1/N=N/c1ccc(C)cc1 |
| InChI | InChI=1S/C21H31ClN6O3/c1-16-6-8-17(9-7-16)26-27-18-19(22)24-21(25-20(18)23-10-5-13-29-2)28(11-14-30-3)12-15-31-4/h6-9H,5,10-15H2,1-4H3,(H,23,24,25)/b27-26+ |
| InChIKey | RPZJCZYLJRFERS-CYYJNZCTSA-N |
| XLogP | 4.40 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|