C27H42N8O — CID 59189066
2-N,6-N-dihexyl-5-[(4-isocyanophenyl)diazenyl]-4-N-(3-methoxypropyl)pyrimidine-2,4,6-triamine (PubChem CID 59189066) has the molecular formula C27H42N8O and a molecular weight of 494.69 g/mol. Its IUPAC name is 2-N,6-N-dihexyl-5-[(4-isocyanophenyl)diazenyl]-4-N-(3-methoxypropyl)pyrimidine-2,4,6-triamine.
| Compound Name | 2-N,6-N-dihexyl-5-[(4-isocyanophenyl)diazenyl]-4-N-(3-methoxypropyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 59189066 |
| Molecular Formula | C27H42N8O |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.35 |
| IUPAC Name | 2-N,6-N-dihexyl-5-[(4-isocyanophenyl)diazenyl]-4-N-(3-methoxypropyl)pyrimidine-2,4,6-triamine |
| SMILES | [C-]#[N+]c1ccc(/N=N/c2c(NCCCCCC)nc(NCCCCCC)nc2NCCCOC)cc1 |
| InChI | InChI=1S/C27H42N8O/c1-5-7-9-11-18-29-25-24(35-34-23-16-14-22(28-3)15-17-23)26(30-20-13-21-36-4)33-27(32-25)31-19-12-10-8-6-2/h14-17H,5-13,18-21H2,1-2,4H3,(H3,29,30,31,32,33)/b35-34+ |
| InChIKey | RBAYUEKYXRALCT-XAHDOWKMSA-N |
| XLogP | 7.88 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|