C19H29N7O — CID 59189067
4-N-(3-methoxypropyl)-2-N,6-N-dimethyl-5-[(4-propylphenyl)diazenyl]pyrimidine-2,4,6-triamine (PubChem CID 59189067) has the molecular formula C19H29N7O and a molecular weight of 371.49 g/mol. Its IUPAC name is 4-N-(3-methoxypropyl)-2-N,6-N-dimethyl-5-[(4-propylphenyl)diazenyl]pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(3-methoxypropyl)-2-N,6-N-dimethyl-5-[(4-propylphenyl)diazenyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 59189067 |
| Molecular Formula | C19H29N7O |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 4-N-(3-methoxypropyl)-2-N,6-N-dimethyl-5-[(4-propylphenyl)diazenyl]pyrimidine-2,4,6-triamine |
| SMILES | CCCc1ccc(/N=N/c2c(NC)nc(NC)nc2NCCCOC)cc1 |
| InChI | InChI=1S/C19H29N7O/c1-5-7-14-8-10-15(11-9-14)25-26-16-17(20-2)23-19(21-3)24-18(16)22-12-6-13-27-4/h8-11H,5-7,12-13H2,1-4H3,(H3,20,21,22,23,24)/b26-25+ |
| InChIKey | WXVYIZNTGAWQFI-OCEACIFDSA-N |
| XLogP | 4.38 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|