C13H16O7 — CID 59189173
[(1S,2S,6R)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylprop-2-enoate (PubChem CID 59189173) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is [(1S,2S,6R)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylprop-2-enoate.
| Compound Name | [(1S,2S,6R)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59189173 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [(1S,2S,6R)-4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C(=O)O[C@H]2C1O[C@@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C13H16O7/c1-5(2)10(14)17-8-6-7(16-11(8)15)9-12(18-6)20-13(3,4)19-9/h6-9,12H,1H2,2-4H3/t6?,7-,8?,9-,12+/m0/s1 |
| InChIKey | YCYPSJCRRVCCKP-AOOBMDLXSA-N |
| XLogP | 0.28 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|