C28H43N2+ — CID 59189222
[4-[(3E)-6-[4-(dimethylamino)-2,3-dimethylcyclopenta-1,3-dien-1-yl]-3,4,5-trimethylhepta-3,5-dien-2-ylidene]-2,3-dimethylcyclopent-2-en-1-ylidene]-dimethylazanium (PubChem CID 59189222) has the molecular formula C28H43N2+ and a molecular weight of 407.67 g/mol. Its IUPAC name is [4-[(3E)-6-[4-(dimethylamino)-2,3-dimethylcyclopenta-1,3-dien-1-yl]-3,4,5-trimethylhepta-3,5-dien-2-ylidene]-2,3-dimethylcyclopent-2-en-1-ylidene]-dimethylazanium.
| Compound Name | [4-[(3E)-6-[4-(dimethylamino)-2,3-dimethylcyclopenta-1,3-dien-1-yl]-3,4,5-trimethylhepta-3,5-dien-2-ylidene]-2,3-dimethylcyclopent-2-en-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 59189222 |
| Molecular Formula | C28H43N2+ |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 407.34 |
| IUPAC Name | [4-[(3E)-6-[4-(dimethylamino)-2,3-dimethylcyclopenta-1,3-dien-1-yl]-3,4,5-trimethylhepta-3,5-dien-2-ylidene]-2,3-dimethylcyclopent-2-en-1-ylidene]-dimethylazanium |
| SMILES | CC1=C(C)C(=[N+](C)C)CC1=C(C)/C(C)=C(\C)C(C)=C(C)C1=C(C)C(C)=C(N(C)C)C1 |
| InChI | InChI=1S/C28H43N2/c1-16(17(2)19(4)25-14-27(29(10)11)23(8)21(25)6)18(3)20(5)26-15-28(30(12)13)24(9)22(26)7/h14-15H2,1-13H3/q+1 |
| InChIKey | HTVYEZSQEMFKQL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|