About 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide
2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide (PubChem CID 59189762) has the molecular formula C16H16N6O4
and a molecular weight of 356.34 g/mol. Its IUPAC name is 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide.
Molecular Properties
| Compound Name | 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide |
| PubChem CID | 59189762 |
| Molecular Formula | C16H16N6O4 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide |
| SMILES | COc1ncc(-c2ccc3c(C(N)=O)c(NC(N)=O)[nH]c3c2)c(OC)n1 |
| InChI | InChI=1S/C16H16N6O4/c1-25-14-9(6-19-16(22-14)26-2)7-3-4-8-10(5-7)20-13(21-15(18)24)11(8)12(17)23/h3-6,20H,1-2H3,(H2,17,23)(H3,18,21,24) |
| InChIKey | FTNLGQHGOZLLRW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide?
The IUPAC name of 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide (CID 59189762) is 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide.
What is the SMILES notation for 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide?
The canonical SMILES for 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide is COc1ncc(-c2ccc3c(C(N)=O)c(NC(N)=O)[nH]c3c2)c(OC)n1.
What is the InChIKey of 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide?
The InChIKey is FTNLGQHGOZLLRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N6O4/c1-25-14-9(6-19-16(22-14)26-2)7-3-4-8-10(5-7)20-13(21-15(18)24)11(8)12(17)23/h3-6,20H,1-2H3,(H2,17,23)(H3,18,21,24).
What are the key properties of 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide?
2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide has a molecular weight of 356.34 g/mol, XLogP of 1.23, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carbamoylamino)-6-(2,4-dimethoxypyrimidin-5-yl)-1H-indole-3-carboxamide is sourced from PubChem (CID 59189762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).