About benzene;3H-pyridin-3-id-6-amine;yttrium
benzene;3H-pyridin-3-id-6-amine;yttrium (PubChem CID 59190357) has the molecular formula C11H10N2Y-2
and a molecular weight of 259.12 g/mol. Its IUPAC name is benzene;3H-pyridin-3-id-6-amine;yttrium.
Molecular Properties
| Compound Name | benzene;3H-pyridin-3-id-6-amine;yttrium |
| PubChem CID | 59190357 |
| Molecular Formula | C11H10N2Y-2 |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | benzene;3H-pyridin-3-id-6-amine;yttrium |
| SMILES | Nc1cc[c-]cn1.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C6H5.C5H5N2.Y/c1-2-4-6-5-3-1;6-5-3-1-2-4-7-5;/h1-5H;1,3-4H,(H2,6,7);/q2*-1; |
| InChIKey | YHHVIPGLDYYRRX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;3H-pyridin-3-id-6-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;3H-pyridin-3-id-6-amine;yttrium?
The IUPAC name of benzene;3H-pyridin-3-id-6-amine;yttrium (CID 59190357) is benzene;3H-pyridin-3-id-6-amine;yttrium.
What is the SMILES notation for benzene;3H-pyridin-3-id-6-amine;yttrium?
The canonical SMILES for benzene;3H-pyridin-3-id-6-amine;yttrium is Nc1cc[c-]cn1.[Y].[c-]1ccccc1.
What is the InChIKey of benzene;3H-pyridin-3-id-6-amine;yttrium?
The InChIKey is YHHVIPGLDYYRRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.C5H5N2.Y/c1-2-4-6-5-3-1;6-5-3-1-2-4-7-5;/h1-5H;1,3-4H,(H2,6,7);/q2*-1;.
What are the key properties of benzene;3H-pyridin-3-id-6-amine;yttrium?
benzene;3H-pyridin-3-id-6-amine;yttrium has a molecular weight of 259.12 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;3H-pyridin-3-id-6-amine;yttrium is sourced from PubChem (CID 59190357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).