C31H36N8O4S — CID 59190685
1-[2-tert-butyl-4-(2,2,4-trimethyl-3-oxopiperazine-1-carbonyl)-1,3-thiazol-5-yl]-3-[4-methyl-3-[6-(5-methyl-1,3,4-oxadiazol-2-yl)-3-pyridinyl]phenyl]urea (PubChem CID 59190685) has the molecular formula C31H36N8O4S and a molecular weight of 616.75 g/mol. Its IUPAC name is 1-[2-tert-butyl-4-(2,2,4-trimethyl-3-oxopiperazine-1-carbonyl)-1,3-thiazol-5-yl]-3-[4-methyl-3-[6-(5-methyl-1,3,4-oxadiazol-2-yl)-3-pyridinyl]phenyl]urea.
| Compound Name | 1-[2-tert-butyl-4-(2,2,4-trimethyl-3-oxopiperazine-1-carbonyl)-1,3-thiazol-5-yl]-3-[4-methyl-3-[6-(5-methyl-1,3,4-oxadiazol-2-yl)-3-pyridinyl]phenyl]urea |
|---|---|
| PubChem CID | 59190685 |
| Molecular Formula | C31H36N8O4S |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 1-[2-tert-butyl-4-(2,2,4-trimethyl-3-oxopiperazine-1-carbonyl)-1,3-thiazol-5-yl]-3-[4-methyl-3-[6-(5-methyl-1,3,4-oxadiazol-2-yl)-3-pyridinyl]phenyl]urea |
| SMILES | Cc1nnc(-c2ccc(-c3cc(NC(=O)Nc4sc(C(C)(C)C)nc4C(=O)N4CCN(C)C(=O)C4(C)C)ccc3C)cn2)o1 |
| InChI | InChI=1S/C31H36N8O4S/c1-17-9-11-20(15-21(17)19-10-12-22(32-16-19)24-37-36-18(2)43-24)33-29(42)35-25-23(34-27(44-25)30(3,4)5)26(40)39-14-13-38(8)28(41)31(39,6)7/h9-12,15-16H,13-14H2,1-8H3,(H2,33,35,42) |
| InChIKey | BVFYKFGXVYQNHF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 146.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |