About 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol
2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol (PubChem CID 59191384) has the molecular formula C13H9F4NO2
and a molecular weight of 287.21 g/mol. Its IUPAC name is 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol.
Molecular Properties
| Compound Name | 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol |
| PubChem CID | 59191384 |
| Molecular Formula | C13H9F4NO2 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol |
| SMILES | Oc1cc(CC(F)(F)F)ccc1Oc1cccc(F)n1 |
| InChI | InChI=1S/C13H9F4NO2/c14-11-2-1-3-12(18-11)20-10-5-4-8(6-9(10)19)7-13(15,16)17/h1-6,19H,7H2 |
| InChIKey | IVXBFUKPDAWSDW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol?
The IUPAC name of 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol (CID 59191384) is 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol.
What is the SMILES notation for 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol?
The canonical SMILES for 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol is Oc1cc(CC(F)(F)F)ccc1Oc1cccc(F)n1.
What is the InChIKey of 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol?
The InChIKey is IVXBFUKPDAWSDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F4NO2/c14-11-2-1-3-12(18-11)20-10-5-4-8(6-9(10)19)7-13(15,16)17/h1-6,19H,7H2.
What are the key properties of 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol?
2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol has a molecular weight of 287.21 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-fluoro-2-pyridinyl)oxy]-5-(2,2,2-trifluoroethyl)phenol is sourced from PubChem (CID 59191384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).