C28H33N5O3 — CID 59191835
1-butyl-4-[phenyl-[5-(3-phenylpiperidin-2-yl)-1,3,4-oxadiazol-2-yl]methyl]piperazine-2,3-dione (PubChem CID 59191835) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-butyl-4-[phenyl-[5-(3-phenylpiperidin-2-yl)-1,3,4-oxadiazol-2-yl]methyl]piperazine-2,3-dione.
| Compound Name | 1-butyl-4-[phenyl-[5-(3-phenylpiperidin-2-yl)-1,3,4-oxadiazol-2-yl]methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 59191835 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 1-butyl-4-[phenyl-[5-(3-phenylpiperidin-2-yl)-1,3,4-oxadiazol-2-yl]methyl]piperazine-2,3-dione |
| SMILES | CCCCN1CCN(C(c2ccccc2)c2nnc(C3NCCCC3c3ccccc3)o2)C(=O)C1=O |
| InChI | InChI=1S/C28H33N5O3/c1-2-3-17-32-18-19-33(28(35)27(32)34)24(21-13-8-5-9-14-21)26-31-30-25(36-26)23-22(15-10-16-29-23)20-11-6-4-7-12-20/h4-9,11-14,22-24,29H,2-3,10,15-19H2,1H3 |
| InChIKey | ZIJPJIWUSIQYFM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|