C12H13F5O — CID 59192723
1-tert-butyl-3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 59192723) has the molecular formula C12H13F5O and a molecular weight of 268.22 g/mol. Its IUPAC name is 1-tert-butyl-3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 1-tert-butyl-3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 59192723 |
| Molecular Formula | C12H13F5O |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-tert-butyl-3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | CC(C)(C)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H13F5O/c1-11(2,3)7-4-8(13)6-9(5-7)18-12(16,17)10(14)15/h4-6,10H,1-3H3 |
| InChIKey | PAZVINXTTJQXCH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|