C20H17F3N4O4S — CID 59193035
(1R)-1-[4-isocyano-3-(trifluoromethyl)anilino]-1-[5-(4-methylperoxysulfanylphenyl)-1,3,4-oxadiazol-2-yl]propan-2-ol (PubChem CID 59193035) has the molecular formula C20H17F3N4O4S and a molecular weight of 466.44 g/mol. Its IUPAC name is (1R)-1-[4-isocyano-3-(trifluoromethyl)anilino]-1-[5-(4-methylperoxysulfanylphenyl)-1,3,4-oxadiazol-2-yl]propan-2-ol.
| Compound Name | (1R)-1-[4-isocyano-3-(trifluoromethyl)anilino]-1-[5-(4-methylperoxysulfanylphenyl)-1,3,4-oxadiazol-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 59193035 |
| Molecular Formula | C20H17F3N4O4S |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | (1R)-1-[4-isocyano-3-(trifluoromethyl)anilino]-1-[5-(4-methylperoxysulfanylphenyl)-1,3,4-oxadiazol-2-yl]propan-2-ol |
| SMILES | [C-]#[N+]c1ccc(N[C@@H](c2nnc(-c3ccc(SOOC)cc3)o2)C(C)O)cc1C(F)(F)F |
| InChI | InChI=1S/C20H17F3N4O4S/c1-11(28)17(25-13-6-9-16(24-2)15(10-13)20(21,22)23)19-27-26-18(30-19)12-4-7-14(8-5-12)32-31-29-3/h4-11,17,25,28H,1,3H3/t11?,17-/m1/s1 |
| InChIKey | PCBVRWBAXGLRHK-DFDFJRDNSA-N |
| XLogP | 5.43 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|