C8H17O4P — CID 591931
2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane (PubChem CID 591931) has the molecular formula C8H17O4P and a molecular weight of 208.19 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane.
| Compound Name | 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 591931 |
| Molecular Formula | C8H17O4P |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane |
| SMILES | COCCOP1OCC(C)(C)CO1 |
| InChI | InChI=1S/C8H17O4P/c1-8(2)6-11-13(12-7-8)10-5-4-9-3/h4-7H2,1-3H3 |
| InChIKey | MBUGOAMMRZPERC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|