About 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane
2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane (PubChem CID 591931) has the molecular formula C8H17O4P
and a molecular weight of 208.19 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane |
| PubChem CID | 591931 |
| Molecular Formula | C8H17O4P |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane |
| SMILES | COCCOP1OCC(C)(C)CO1 |
| InChI | InChI=1S/C8H17O4P/c1-8(2)6-11-13(12-7-8)10-5-4-9-3/h4-7H2,1-3H3 |
| InChIKey | MBUGOAMMRZPERC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane?
The IUPAC name of 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane (CID 591931) is 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane.
What is the SMILES notation for 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane?
The canonical SMILES for 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane is COCCOP1OCC(C)(C)CO1.
What is the InChIKey of 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane?
The InChIKey is MBUGOAMMRZPERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O4P/c1-8(2)6-11-13(12-7-8)10-5-4-9-3/h4-7H2,1-3H3.
What are the key properties of 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane?
2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane has a molecular weight of 208.19 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)-5,5-dimethyl-1,3,2-dioxaphosphinane is sourced from PubChem (CID 591931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).