C11H26N2 — CID 59193160
N-butyl-N,N',N',2-tetramethylpropane-1,3-diamine (PubChem CID 59193160) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is N-butyl-N,N',N',2-tetramethylpropane-1,3-diamine.
| Compound Name | N-butyl-N,N',N',2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 59193160 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | N-butyl-N,N',N',2-tetramethylpropane-1,3-diamine |
| SMILES | CCCCN(C)CC(C)CN(C)C |
| InChI | InChI=1S/C11H26N2/c1-6-7-8-13(5)10-11(2)9-12(3)4/h11H,6-10H2,1-5H3 |
| InChIKey | CXCJCVHICUKJEY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |