About 2,2-difluoro-N'-propanoylpropanediamide
2,2-difluoro-N'-propanoylpropanediamide (PubChem CID 59193585) has the molecular formula C6H8F2N2O3
and a molecular weight of 194.14 g/mol. Its IUPAC name is 2,2-difluoro-N'-propanoylpropanediamide.
Molecular Properties
| Compound Name | 2,2-difluoro-N'-propanoylpropanediamide |
| PubChem CID | 59193585 |
| Molecular Formula | C6H8F2N2O3 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2,2-difluoro-N'-propanoylpropanediamide |
| SMILES | CCC(=O)NC(=O)C(F)(F)C(N)=O |
| InChI | InChI=1S/C6H8F2N2O3/c1-2-3(11)10-5(13)6(7,8)4(9)12/h2H2,1H3,(H2,9,12)(H,10,11,13) |
| InChIKey | AQCMJQDFBRRSNI-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-N'-propanoylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N'-propanoylpropanediamide?
The IUPAC name of 2,2-difluoro-N'-propanoylpropanediamide (CID 59193585) is 2,2-difluoro-N'-propanoylpropanediamide.
What is the SMILES notation for 2,2-difluoro-N'-propanoylpropanediamide?
The canonical SMILES for 2,2-difluoro-N'-propanoylpropanediamide is CCC(=O)NC(=O)C(F)(F)C(N)=O.
What is the InChIKey of 2,2-difluoro-N'-propanoylpropanediamide?
The InChIKey is AQCMJQDFBRRSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2O3/c1-2-3(11)10-5(13)6(7,8)4(9)12/h2H2,1H3,(H2,9,12)(H,10,11,13).
What are the key properties of 2,2-difluoro-N'-propanoylpropanediamide?
2,2-difluoro-N'-propanoylpropanediamide has a molecular weight of 194.14 g/mol, XLogP of -0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N'-propanoylpropanediamide is sourced from PubChem (CID 59193585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).