C26H21FN2O3 — CID 59193993
N-(2-cyanoethyl)-3-[2-[(3-fluoro-4-methoxyphenyl)methyl]-1-benzofuran-7-yl]benzamide (PubChem CID 59193993) has the molecular formula C26H21FN2O3 and a molecular weight of 428.46 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-[2-[(3-fluoro-4-methoxyphenyl)methyl]-1-benzofuran-7-yl]benzamide.
| Compound Name | N-(2-cyanoethyl)-3-[2-[(3-fluoro-4-methoxyphenyl)methyl]-1-benzofuran-7-yl]benzamide |
|---|---|
| PubChem CID | 59193993 |
| Molecular Formula | C26H21FN2O3 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-(2-cyanoethyl)-3-[2-[(3-fluoro-4-methoxyphenyl)methyl]-1-benzofuran-7-yl]benzamide |
| SMILES | COc1ccc(Cc2cc3cccc(-c4cccc(C(=O)NCCC#N)c4)c3o2)cc1F |
| InChI | InChI=1S/C26H21FN2O3/c1-31-24-10-9-17(14-23(24)27)13-21-16-19-6-3-8-22(25(19)32-21)18-5-2-7-20(15-18)26(30)29-12-4-11-28/h2-3,5-10,14-16H,4,12-13H2,1H3,(H,29,30) |
| InChIKey | FUEUFRKGVZYFBZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|