C23H16F3NO2S — CID 59194000
4-[2-[[3-(trifluoromethyl)phenoxy]methyl]-1-benzothiophen-7-yl]benzamide (PubChem CID 59194000) has the molecular formula C23H16F3NO2S and a molecular weight of 427.45 g/mol. Its IUPAC name is 4-[2-[[3-(trifluoromethyl)phenoxy]methyl]-1-benzothiophen-7-yl]benzamide.
| Compound Name | 4-[2-[[3-(trifluoromethyl)phenoxy]methyl]-1-benzothiophen-7-yl]benzamide |
|---|---|
| PubChem CID | 59194000 |
| Molecular Formula | C23H16F3NO2S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 4-[2-[[3-(trifluoromethyl)phenoxy]methyl]-1-benzothiophen-7-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cccc3cc(COc4cccc(C(F)(F)F)c4)sc23)cc1 |
| InChI | InChI=1S/C23H16F3NO2S/c24-23(25,26)17-4-2-5-18(12-17)29-13-19-11-16-3-1-6-20(21(16)30-19)14-7-9-15(10-8-14)22(27)28/h1-12H,13H2,(H2,27,28) |
| InChIKey | JMUFBSOKJXKTBA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |