C17H28O4Si — CID 59194188
(3aR,4R,5R,6aS)-4-[(E)-3-oxobut-1-enyl]-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 59194188) has the molecular formula C17H28O4Si and a molecular weight of 324.49 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E)-3-oxobut-1-enyl]-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E)-3-oxobut-1-enyl]-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 59194188 |
| Molecular Formula | C17H28O4Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E)-3-oxobut-1-enyl]-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@@H]2OC(=O)C[C@@H]2[C@H]1/C=C/C(C)=O |
| InChI | InChI=1S/C17H28O4Si/c1-5-22(6-2,7-3)21-16-11-15-14(10-17(19)20-15)13(16)9-8-12(4)18/h8-9,13-16H,5-7,10-11H2,1-4H3/b9-8+/t13-,14-,15+,16-/m1/s1 |
| InChIKey | QTWROUXCLHFBLW-CPBAPSRBSA-N |
| XLogP | 3.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|