About [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide
[2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide (PubChem CID 59194417) has the molecular formula C26H10F6N2
and a molecular weight of 464.37 g/mol. Its IUPAC name is [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide.
Molecular Properties
| Compound Name | [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide |
| PubChem CID | 59194417 |
| Molecular Formula | C26H10F6N2 |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide |
| SMILES | N#CN=C1c2cc(-c3cc(F)c(F)c(F)c3)ccc2-c2ccc(-c3cc(F)c(F)c(F)c3)cc21 |
| InChI | InChI=1S/C26H10F6N2/c27-20-7-14(8-21(28)24(20)31)12-1-3-16-17-4-2-13(15-9-22(29)25(32)23(30)10-15)6-19(17)26(34-11-33)18(16)5-12/h1-10H |
| InChIKey | JRNXLAIHYKJXHV-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide?
The IUPAC name of [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide (CID 59194417) is [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide.
What is the SMILES notation for [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide?
The canonical SMILES for [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide is N#CN=C1c2cc(-c3cc(F)c(F)c(F)c3)ccc2-c2ccc(-c3cc(F)c(F)c(F)c3)cc21.
What is the InChIKey of [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide?
The InChIKey is JRNXLAIHYKJXHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H10F6N2/c27-20-7-14(8-21(28)24(20)31)12-1-3-16-17-4-2-13(15-9-22(29)25(32)23(30)10-15)6-19(17)26(34-11-33)18(16)5-12/h1-10H.
What are the key properties of [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide?
[2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide has a molecular weight of 464.37 g/mol, XLogP of 7.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,7-bis(3,4,5-trifluorophenyl)fluoren-9-ylidene]cyanamide is sourced from PubChem (CID 59194417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).